C27H27N3O4S3 — CID 6203653
6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)hexanamide (PubChem CID 6203653) has the molecular formula C27H27N3O4S3 and a molecular weight of 553.73 g/mol. Its IUPAC name is 6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)hexanamide.
| Compound Name | 6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 6203653 |
| Molecular Formula | C27H27N3O4S3 |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)hexanamide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCCCCC(=O)Nc3nc(-c4ccccc4)cs3)C2=O)cc1OC |
| InChI | InChI=1S/C27H27N3O4S3/c1-33-21-13-12-18(15-22(21)34-2)16-23-25(32)30(27(35)37-23)14-8-4-7-11-24(31)29-26-28-20(17-36-26)19-9-5-3-6-10-19/h3,5-6,9-10,12-13,15-17H,4,7-8,11,14H2,1-2H3,(H,28,29,31)/b23-16- |
| InChIKey | WORPEMUCVJKGMO-KQWNVCNZSA-N |
| XLogP | 6.23 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|