C22H18BrN3O3S2 — CID 6531572
2-bromo-N'-[3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide (PubChem CID 6531572) has the molecular formula C22H18BrN3O3S2 and a molecular weight of 516.44 g/mol. Its IUPAC name is 2-bromo-N'-[3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide.
| Compound Name | 2-bromo-N'-[3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 6531572 |
| Molecular Formula | C22H18BrN3O3S2 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 515.00 |
| IUPAC Name | 2-bromo-N'-[3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide |
| SMILES | O=C(CCN1C(=O)/C(=C/C=C/c2ccccc2)SC1=S)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C22H18BrN3O3S2/c23-17-11-5-4-10-16(17)20(28)25-24-19(27)13-14-26-21(29)18(31-22(26)30)12-6-9-15-7-2-1-3-8-15/h1-12H,13-14H2,(H,24,27)(H,25,28)/b9-6+,18-12- |
| InChIKey | KLEVTFWLHNPALY-YKYHQJSKSA-N |
| XLogP | 4.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|