C23H21N3O4S2 — CID 4760280
N'-[4-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanoyl]-4-hydroxybenzohydrazide (PubChem CID 4760280) has the molecular formula C23H21N3O4S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N'-[4-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanoyl]-4-hydroxybenzohydrazide.
| Compound Name | N'-[4-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanoyl]-4-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 4760280 |
| Molecular Formula | C23H21N3O4S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N'-[4-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanoyl]-4-hydroxybenzohydrazide |
| SMILES | O=C(CCCN1C(=O)C(=CC=Cc2ccccc2)SC1=S)NNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H21N3O4S2/c27-18-13-11-17(12-14-18)21(29)25-24-20(28)10-5-15-26-22(30)19(32-23(26)31)9-4-8-16-6-2-1-3-7-16/h1-4,6-9,11-14,27H,5,10,15H2,(H,24,28)(H,25,29) |
| InChIKey | OTTYSUCSKUJKDY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|