C20H16N4O3S2 — CID 6531538
N'-[2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]pyridine-3-carbohydrazide (PubChem CID 6531538) has the molecular formula C20H16N4O3S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is N'-[2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 6531538 |
| Molecular Formula | C20H16N4O3S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N'-[2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]pyridine-3-carbohydrazide |
| SMILES | O=C(CN1C(=O)/C(=C/C=C/c2ccccc2)SC1=S)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C20H16N4O3S2/c25-17(22-23-18(26)15-9-5-11-21-12-15)13-24-19(27)16(29-20(24)28)10-4-8-14-6-2-1-3-7-14/h1-12H,13H2,(H,22,25)(H,23,26)/b8-4+,16-10- |
| InChIKey | QRNVIEIWTPNBPI-MMPACVFLSA-N |
| XLogP | 2.30 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|