C19H15BrN4O3S2 — CID 3142981
N'-[3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]pyridine-3-carbohydrazide (PubChem CID 3142981) has the molecular formula C19H15BrN4O3S2 and a molecular weight of 491.39 g/mol. Its IUPAC name is N'-[3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 3142981 |
| Molecular Formula | C19H15BrN4O3S2 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | N'-[3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]pyridine-3-carbohydrazide |
| SMILES | O=C(CCN1C(=O)C(=Cc2cccc(Br)c2)SC1=S)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C19H15BrN4O3S2/c20-14-5-1-3-12(9-14)10-15-18(27)24(19(28)29-15)8-6-16(25)22-23-17(26)13-4-2-7-21-11-13/h1-5,7,9-11H,6,8H2,(H,22,25)(H,23,26) |
| InChIKey | YTBWCFUTANFPRB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|