C20H15BrFN3O3S2 — CID 4755871
N'-[3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-4-fluorobenzohydrazide (PubChem CID 4755871) has the molecular formula C20H15BrFN3O3S2 and a molecular weight of 508.39 g/mol. Its IUPAC name is N'-[3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 4755871 |
| Molecular Formula | C20H15BrFN3O3S2 |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 506.97 |
| IUPAC Name | N'-[3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-4-fluorobenzohydrazide |
| SMILES | O=C(CCN1C(=O)C(=Cc2cccc(Br)c2)SC1=S)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15BrFN3O3S2/c21-14-3-1-2-12(10-14)11-16-19(28)25(20(29)30-16)9-8-17(26)23-24-18(27)13-4-6-15(22)7-5-13/h1-7,10-11H,8-9H2,(H,23,26)(H,24,27) |
| InChIKey | QFKGNXHZSXKQAS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|