C25H22N4O6S3 — CID 4758555
methyl 4-[[3-[4-[2-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinyl]-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 4758555) has the molecular formula C25H22N4O6S3 and a molecular weight of 570.67 g/mol. Its IUPAC name is methyl 4-[[3-[4-[2-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinyl]-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[3-[4-[2-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinyl]-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4758555 |
| Molecular Formula | C25H22N4O6S3 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | methyl 4-[[3-[4-[2-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinyl]-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2SC(=S)N(CCCC(=O)NNC(=O)CSc3nc4ccccc4o3)C2=O)cc1 |
| InChI | InChI=1S/C25H22N4O6S3/c1-34-23(33)16-10-8-15(9-11-16)13-19-22(32)29(25(36)38-19)12-4-7-20(30)27-28-21(31)14-37-24-26-17-5-2-3-6-18(17)35-24/h2-3,5-6,8-11,13H,4,7,12,14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | KXBDYABZXJOEHK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|