C13H13NO6S3 — CID 2874043
2-[5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid (PubChem CID 2874043) has the molecular formula C13H13NO6S3 and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid.
| Compound Name | 2-[5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 2874043 |
| Molecular Formula | C13H13NO6S3 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 2-[5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
| SMILES | COc1cc(C=C2SC(=S)N(CCS(=O)(=O)O)C2=O)ccc1O |
| InChI | InChI=1S/C13H13NO6S3/c1-20-10-6-8(2-3-9(10)15)7-11-12(16)14(13(21)22-11)4-5-23(17,18)19/h2-3,6-7,15H,4-5H2,1H3,(H,17,18,19) |
| InChIKey | SEDNIMBONGWZIC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|