C24H18N2O8S2 — CID 2720081
[2-methoxy-4-[(E)-[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 2720081) has the molecular formula C24H18N2O8S2 and a molecular weight of 526.55 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-methoxy-4-[(E)-[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 2720081 |
| Molecular Formula | C24H18N2O8S2 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | [2-methoxy-4-[(E)-[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3ccc([N+](=O)[O-])cc3)C2=O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18N2O8S2/c1-33-21-13-17(9-12-20(21)34-36(31,32)19-5-3-2-4-6-19)14-22-23(27)25(24(28)35-22)15-16-7-10-18(11-8-16)26(29)30/h2-14H,15H2,1H3/b22-14+ |
| InChIKey | JDAHGNGFONMPPN-HYARGMPZSA-N |
| XLogP | 4.61 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|