C24H17F2NO6S2 — CID 3798294
[4-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 3798294) has the molecular formula C24H17F2NO6S2 and a molecular weight of 517.53 g/mol. Its IUPAC name is [4-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3798294 |
| Molecular Formula | C24H17F2NO6S2 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | [4-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1cc(C=C2SC(=O)N(Cc3ccccc3F)C2=O)ccc1OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H17F2NO6S2/c1-32-21-12-15(6-11-20(21)33-35(30,31)18-9-7-17(25)8-10-18)13-22-23(28)27(24(29)34-22)14-16-4-2-3-5-19(16)26/h2-13H,14H2,1H3 |
| InChIKey | TZIAALXEMQIQIF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|