C28H25N3O7S — CID 18773197
N-(3,4-dimethylphenyl)-2-[2-methoxy-4-[(E)-[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 18773197) has the molecular formula C28H25N3O7S and a molecular weight of 547.59 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[2-methoxy-4-[(E)-[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[2-methoxy-4-[(E)-[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 18773197 |
| Molecular Formula | C28H25N3O7S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[2-methoxy-4-[(E)-[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3ccc([N+](=O)[O-])cc3)C2=O)ccc1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C28H25N3O7S/c1-17-4-8-21(12-18(17)2)29-26(32)16-38-23-11-7-20(13-24(23)37-3)14-25-27(33)30(28(34)39-25)15-19-5-9-22(10-6-19)31(35)36/h4-14H,15-16H2,1-3H3,(H,29,32)/b25-14+ |
| InChIKey | LCUDCUTZYDNLBX-AFUMVMLFSA-N |
| XLogP | 5.47 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|