C24H18N2O7S3 — CID 73403755
[4-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate (PubChem CID 73403755) has the molecular formula C24H18N2O7S3 and a molecular weight of 542.62 g/mol. Its IUPAC name is [4-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate.
| Compound Name | [4-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 73403755 |
| Molecular Formula | C24H18N2O7S3 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | [4-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
| SMILES | COc1cc(C=C2SC(=S)N(Cc3ccccc3)C2=O)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18N2O7S3/c1-32-20-13-17(14-21-23(27)25(24(34)35-21)15-16-7-3-2-4-8-16)11-12-19(20)33-36(30,31)22-10-6-5-9-18(22)26(28)29/h2-14H,15H2,1H3 |
| InChIKey | XTTLSZFVSLTGFN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|