C19H16N2O7S3 — CID 2272404
[4-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate (PubChem CID 2272404) has the molecular formula C19H16N2O7S3 and a molecular weight of 480.55 g/mol. Its IUPAC name is [4-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 2272404 |
| Molecular Formula | C19H16N2O7S3 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | [4-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
| SMILES | CCN1C(=O)/C(=C/c2ccc(OS(=O)(=O)c3ccccc3[N+](=O)[O-])c(OC)c2)SC1=S |
| InChI | InChI=1S/C19H16N2O7S3/c1-3-20-18(22)16(30-19(20)29)11-12-8-9-14(15(10-12)27-2)28-31(25,26)17-7-5-4-6-13(17)21(23)24/h4-11H,3H2,1-2H3/b16-11- |
| InChIKey | JCSCIXCELUUPFP-WJDWOHSUSA-N |
| XLogP | 3.59 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|