C25H17F2N3O9S2 — CID 126262297
[4-[(Z)-[3-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate (PubChem CID 126262297) has the molecular formula C25H17F2N3O9S2 and a molecular weight of 605.55 g/mol. Its IUPAC name is [4-[(Z)-[3-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-[3-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126262297 |
| Molecular Formula | C25H17F2N3O9S2 |
| Molecular Weight | 605.55 g/mol |
| Exact Mass | 605.04 |
| IUPAC Name | [4-[(Z)-[3-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(F)cc3F)C2=O)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H17F2N3O9S2/c1-38-20-10-14(6-9-19(20)39-41(36,37)22-5-3-2-4-18(22)30(34)35)11-21-24(32)29(25(33)40-21)13-23(31)28-17-8-7-15(26)12-16(17)27/h2-12H,13H2,1H3,(H,28,31)/b21-11- |
| InChIKey | OAGZIZICODNBBP-NHDPSOOVSA-N |
| XLogP | 4.32 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|