C21H15F2N3O5S — CID 5097355
2-[5-[[4-(cyanomethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 5097355) has the molecular formula C21H15F2N3O5S and a molecular weight of 459.43 g/mol. Its IUPAC name is 2-[5-[[4-(cyanomethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[5-[[4-(cyanomethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 5097355 |
| Molecular Formula | C21H15F2N3O5S |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-[5-[[4-(cyanomethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | COc1cc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3F)C2=O)ccc1OCC#N |
| InChI | InChI=1S/C21H15F2N3O5S/c1-30-17-8-12(2-5-16(17)31-7-6-24)9-18-20(28)26(21(29)32-18)11-19(27)25-15-4-3-13(22)10-14(15)23/h2-5,8-10H,7,11H2,1H3,(H,25,27) |
| InChIKey | LBBMWTMQSGGXJY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|