C22H16F2N2O5S — CID 3635129
N-(2,4-difluorophenyl)-2-[5-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 3635129) has the molecular formula C22H16F2N2O5S and a molecular weight of 458.44 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[5-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[5-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3635129 |
| Molecular Formula | C22H16F2N2O5S |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[5-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | C#CCOc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3F)C2=O)cc1OC |
| InChI | InChI=1S/C22H16F2N2O5S/c1-3-8-31-17-7-4-13(9-18(17)30-2)10-19-21(28)26(22(29)32-19)12-20(27)25-16-6-5-14(23)11-15(16)24/h1,4-7,9-11H,8,12H2,2H3,(H,25,27) |
| InChIKey | HHFPKFVGBTWULT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|