C24H15F3N2O7S3 — CID 50871526
[2-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-nitrobenzenesulfonate (PubChem CID 50871526) has the molecular formula C24H15F3N2O7S3 and a molecular weight of 596.59 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-nitrobenzenesulfonate.
| Compound Name | [2-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 50871526 |
| Molecular Formula | C24H15F3N2O7S3 |
| Molecular Weight | 596.59 g/mol |
| Exact Mass | 596.00 |
| IUPAC Name | [2-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenyl] 2-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H15F3N2O7S3/c1-35-19-11-14(9-10-18(19)36-39(33,34)21-8-3-2-7-17(21)29(31)32)12-20-22(30)28(23(37)38-20)16-6-4-5-15(13-16)24(25,26)27/h2-13H,1H3/b20-12+ |
| InChIKey | GQUOVGYCRIXNPL-UDWIEESQSA-N |
| XLogP | 5.80 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|