C23H14F3N3O5S2 — CID 126336351
(5E)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 126336351) has the molecular formula C23H14F3N3O5S2 and a molecular weight of 533.51 g/mol. Its IUPAC name is (5E)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126336351 |
| Molecular Formula | C23H14F3N3O5S2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | (5E)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)ccc1Oc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H14F3N3O5S2/c1-33-18-10-13(7-8-17(18)34-20-16(29(31)32)6-3-9-27-20)11-19-21(30)28(22(35)36-19)15-5-2-4-14(12-15)23(24,25)26/h2-12H,1H3/b19-11+ |
| InChIKey | JSNJKMOMJGOSCI-YBFXNURJSA-N |
| XLogP | 6.22 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|