C22H14BrN3O5S2 — CID 126335045
(5Z)-3-(4-bromophenyl)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126335045) has the molecular formula C22H14BrN3O5S2 and a molecular weight of 544.41 g/mol. Its IUPAC name is (5Z)-3-(4-bromophenyl)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(4-bromophenyl)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126335045 |
| Molecular Formula | C22H14BrN3O5S2 |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 542.96 |
| IUPAC Name | (5Z)-3-(4-bromophenyl)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\SC(=S)N(c3ccc(Br)cc3)C2=O)ccc1Oc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14BrN3O5S2/c1-30-18-11-13(4-9-17(18)31-20-16(26(28)29)3-2-10-24-20)12-19-21(27)25(22(32)33-19)15-7-5-14(23)6-8-15/h2-12H,1H3/b19-12- |
| InChIKey | ACBWKOJJYKYLFD-UNOMPAQXSA-N |
| XLogP | 5.96 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|