C17H13N3O7S2 — CID 2287318
[2-methoxy-4-[(Z)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 2-nitrobenzenesulfonate (PubChem CID 2287318) has the molecular formula C17H13N3O7S2 and a molecular weight of 435.44 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 2-nitrobenzenesulfonate.
| Compound Name | [2-methoxy-4-[(Z)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 2287318 |
| Molecular Formula | C17H13N3O7S2 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | [2-methoxy-4-[(Z)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 2-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2\NC(=S)NC2=O)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13N3O7S2/c1-26-14-9-10(8-11-16(21)19-17(28)18-11)6-7-13(14)27-29(24,25)15-5-3-2-4-12(15)20(22)23/h2-9H,1H3,(H2,18,19,21,28)/b11-8- |
| InChIKey | KVXWSZAFQMAXRK-FLIBITNWSA-N |
| XLogP | 1.72 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|