C23H15N3O7S2 — CID 2891035
[2-methoxy-4-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] 2-nitrobenzenesulfonate (PubChem CID 2891035) has the molecular formula C23H15N3O7S2 and a molecular weight of 509.52 g/mol. Its IUPAC name is [2-methoxy-4-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] 2-nitrobenzenesulfonate.
| Compound Name | [2-methoxy-4-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 2891035 |
| Molecular Formula | C23H15N3O7S2 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | [2-methoxy-4-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] 2-nitrobenzenesulfonate |
| SMILES | COc1cc(C=c2sc3nc4ccccc4n3c2=O)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15N3O7S2/c1-32-19-12-14(13-20-22(27)25-16-7-3-2-6-15(16)24-23(25)34-20)10-11-18(19)33-35(30,31)21-9-5-4-8-17(21)26(28)29/h2-13H,1H3 |
| InChIKey | GEQDFASRZXPMDZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|