C31H27N3O10S2 — CID 92907638
ethyl (2E,5S)-2-[[3-methoxy-4-(2-nitrophenyl)sulfonyloxyphenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 92907638) has the molecular formula C31H27N3O10S2 and a molecular weight of 665.70 g/mol. Its IUPAC name is ethyl (2E,5S)-2-[[3-methoxy-4-(2-nitrophenyl)sulfonyloxyphenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-[[3-methoxy-4-(2-nitrophenyl)sulfonyloxyphenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 92907638 |
| Molecular Formula | C31H27N3O10S2 |
| Molecular Weight | 665.70 g/mol |
| Exact Mass | 665.11 |
| IUPAC Name | ethyl (2E,5S)-2-[[3-methoxy-4-(2-nitrophenyl)sulfonyloxyphenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3ccc(OS(=O)(=O)c4ccccc4[N+](=O)[O-])c(OC)c3)c(=O)n2[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H27N3O10S2/c1-5-43-30(36)27-18(2)32-31-33(28(27)20-11-13-21(41-3)14-12-20)29(35)25(45-31)17-19-10-15-23(24(16-19)42-4)44-46(39,40)26-9-7-6-8-22(26)34(37)38/h6-17,28H,5H2,1-4H3/b25-17+/t28-/m0/s1 |
| InChIKey | WAQLCJPTLWVHKQ-DBLMTGOPSA-N |
| XLogP | 3.49 |
| TPSA | 165.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|