C30H24ClN3O9S2 — CID 6310889
ethyl (2Z)-2-[[5-chloro-2-(2-nitrophenyl)sulfonyloxyphenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 6310889) has the molecular formula C30H24ClN3O9S2 and a molecular weight of 670.12 g/mol. Its IUPAC name is ethyl (2Z)-2-[[5-chloro-2-(2-nitrophenyl)sulfonyloxyphenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z)-2-[[5-chloro-2-(2-nitrophenyl)sulfonyloxyphenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 6310889 |
| Molecular Formula | C30H24ClN3O9S2 |
| Molecular Weight | 670.12 g/mol |
| Exact Mass | 669.06 |
| IUPAC Name | ethyl (2Z)-2-[[5-chloro-2-(2-nitrophenyl)sulfonyloxyphenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3cc(Cl)ccc3OS(=O)(=O)c3ccccc3[N+](=O)[O-])c(=O)n2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H24ClN3O9S2/c1-4-42-29(36)26-17(2)32-30-33(27(26)18-9-12-21(41-3)13-10-18)28(35)24(44-30)16-19-15-20(31)11-14-23(19)43-45(39,40)25-8-6-5-7-22(25)34(37)38/h5-16,27H,4H2,1-3H3/b24-16- |
| InChIKey | KWIYGXVTUIJENL-JLPGSUDCSA-N |
| XLogP | 4.14 |
| TPSA | 156.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.12 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|