C29H21ClN4O8S — CID 124543428
ethyl (2Z,5S)-5-(4-chlorophenyl)-2-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124543428) has the molecular formula C29H21ClN4O8S and a molecular weight of 621.03 g/mol. Its IUPAC name is ethyl (2Z,5S)-5-(4-chlorophenyl)-2-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5S)-5-(4-chlorophenyl)-2-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124543428 |
| Molecular Formula | C29H21ClN4O8S |
| Molecular Weight | 621.03 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | ethyl (2Z,5S)-5-(4-chlorophenyl)-2-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccccc3Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(=O)n2[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H21ClN4O8S/c1-3-41-28(36)25-16(2)31-29-32(26(25)17-8-10-19(30)11-9-17)27(35)24(43-29)14-18-6-4-5-7-22(18)42-23-13-12-20(33(37)38)15-21(23)34(39)40/h4-15,26H,3H2,1-2H3/b24-14-/t26-/m0/s1 |
| InChIKey | FDLKFUQSDVEEMG-QARYAGPDSA-N |
| XLogP | 5.06 |
| TPSA | 156.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.03 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|