C23H18N3O6S- — CID 2140281
2-[(E)-[(5S)-6-ethoxycarbonyl-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-4-nitrophenolate (PubChem CID 2140281) has the molecular formula C23H18N3O6S- and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-[(E)-[(5S)-6-ethoxycarbonyl-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(E)-[(5S)-6-ethoxycarbonyl-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 2140281 |
| Molecular Formula | C23H18N3O6S- |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 2-[(E)-[(5S)-6-ethoxycarbonyl-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-4-nitrophenolate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cc([N+](=O)[O-])ccc3[O-])c(=O)n2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H19N3O6S/c1-3-32-22(29)19-13(2)24-23-25(20(19)14-7-5-4-6-8-14)21(28)18(33-23)12-15-11-16(26(30)31)9-10-17(15)27/h4-12,20,27H,3H2,1-2H3/p-1/b18-12+/t20-/m0/s1 |
| InChIKey | UHQWTQXDPCQBGP-YWFITGJYSA-M |
| XLogP | 1.78 |
| TPSA | 126.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|