C28H28N4O7S — CID 6076062
ethyl (2Z)-5-(4-methoxyphenyl)-7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 6076062) has the molecular formula C28H28N4O7S and a molecular weight of 564.62 g/mol. Its IUPAC name is ethyl (2Z)-5-(4-methoxyphenyl)-7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z)-5-(4-methoxyphenyl)-7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 6076062 |
| Molecular Formula | C28H28N4O7S |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | ethyl (2Z)-5-(4-methoxyphenyl)-7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3cc([N+](=O)[O-])ccc3N3CCOCC3)c(=O)n2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H28N4O7S/c1-4-39-27(34)24-17(2)29-28-31(25(24)18-5-8-21(37-3)9-6-18)26(33)23(40-28)16-19-15-20(32(35)36)7-10-22(19)30-11-13-38-14-12-30/h5-10,15-16,25H,4,11-14H2,1-3H3/b23-16- |
| InChIKey | KMMGYJQREGHYGH-KQWNVCNZSA-N |
| XLogP | 2.55 |
| TPSA | 125.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|