C30H33N5O5S — CID 11945295
ethyl (2E,5R)-5-[4-(dimethylamino)phenyl]-7-methyl-2-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 11945295) has the molecular formula C30H33N5O5S and a molecular weight of 575.69 g/mol. Its IUPAC name is ethyl (2E,5R)-5-[4-(dimethylamino)phenyl]-7-methyl-2-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-5-[4-(dimethylamino)phenyl]-7-methyl-2-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 11945295 |
| Molecular Formula | C30H33N5O5S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | ethyl (2E,5R)-5-[4-(dimethylamino)phenyl]-7-methyl-2-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cc([N+](=O)[O-])ccc3N3CCCCC3)c(=O)n2[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C30H33N5O5S/c1-5-40-29(37)26-19(2)31-30-34(27(26)20-9-11-22(12-10-20)32(3)4)28(36)25(41-30)18-21-17-23(35(38)39)13-14-24(21)33-15-7-6-8-16-33/h9-14,17-18,27H,5-8,15-16H2,1-4H3/b25-18+/t27-/m1/s1 |
| InChIKey | DNQFFPJGGLVIMK-NTWBUQQASA-N |
| XLogP | 3.76 |
| TPSA | 110.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|