C32H27FN4O5S — CID 4189559
ethyl 5-(4-fluorophenyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 4189559) has the molecular formula C32H27FN4O5S and a molecular weight of 598.66 g/mol. Its IUPAC name is ethyl 5-(4-fluorophenyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(4-fluorophenyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4189559 |
| Molecular Formula | C32H27FN4O5S |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | ethyl 5-(4-fluorophenyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2sc(=Cc3cc([N+](=O)[O-])ccc3N3CCCC3)c(=O)n2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C32H27FN4O5S/c1-2-42-31(39)27-28(20-8-4-3-5-9-20)34-32-36(29(27)21-10-12-23(33)13-11-21)30(38)26(43-32)19-22-18-24(37(40)41)14-15-25(22)35-16-6-7-17-35/h3-5,8-15,18-19,29H,2,6-7,16-17H2,1H3 |
| InChIKey | RGDOFVJROYIEQL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|