C33H30N4O6S — CID 98094407
ethyl (2E,5S)-5-(4-methoxyphenyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98094407) has the molecular formula C33H30N4O6S and a molecular weight of 610.69 g/mol. Its IUPAC name is ethyl (2E,5S)-5-(4-methoxyphenyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-5-(4-methoxyphenyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98094407 |
| Molecular Formula | C33H30N4O6S |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | ethyl (2E,5S)-5-(4-methoxyphenyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C/c3cc([N+](=O)[O-])ccc3N3CCCC3)c(=O)n2[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H30N4O6S/c1-3-43-32(39)28-29(21-9-5-4-6-10-21)34-33-36(30(28)22-11-14-25(42-2)15-12-22)31(38)27(44-33)20-23-19-24(37(40)41)13-16-26(23)35-17-7-8-18-35/h4-6,9-16,19-20,30H,3,7-8,17-18H2,1-2H3/b27-20+/t30-/m0/s1 |
| InChIKey | YPLUTGVBWMVEKY-PVPFEYIBSA-N |
| XLogP | 4.45 |
| TPSA | 116.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|