C34H31N5O7S — CID 4149695
ethyl 5-(1,3-benzodioxol-5-yl)-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 4149695) has the molecular formula C34H31N5O7S and a molecular weight of 653.72 g/mol. Its IUPAC name is ethyl 5-(1,3-benzodioxol-5-yl)-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(1,3-benzodioxol-5-yl)-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4149695 |
| Molecular Formula | C34H31N5O7S |
| Molecular Weight | 653.72 g/mol |
| Exact Mass | 653.19 |
| IUPAC Name | ethyl 5-(1,3-benzodioxol-5-yl)-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2sc(=Cc3cc([N+](=O)[O-])ccc3N3CCN(C)CC3)c(=O)n2C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C34H31N5O7S/c1-3-44-33(41)29-30(21-7-5-4-6-8-21)35-34-38(31(29)22-9-12-26-27(18-22)46-20-45-26)32(40)28(47-34)19-23-17-24(39(42)43)10-11-25(23)37-15-13-36(2)14-16-37/h4-12,17-19,31H,3,13-16,20H2,1-2H3 |
| InChIKey | GZDRWEXOWGLHGV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 128.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|