C33H31N5O5S — CID 4149595
ethyl 2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 4149595) has the molecular formula C33H31N5O5S and a molecular weight of 609.71 g/mol. Its IUPAC name is ethyl 2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4149595 |
| Molecular Formula | C33H31N5O5S |
| Molecular Weight | 609.71 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | ethyl 2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2sc(=Cc3cc([N+](=O)[O-])ccc3N3CCN(C)CC3)c(=O)n2C1c1ccccc1 |
| InChI | InChI=1S/C33H31N5O5S/c1-3-43-32(40)28-29(22-10-6-4-7-11-22)34-33-37(30(28)23-12-8-5-9-13-23)31(39)27(44-33)21-24-20-25(38(41)42)14-15-26(24)36-18-16-35(2)17-19-36/h4-15,20-21,30H,3,16-19H2,1-2H3 |
| InChIKey | WHUHDDNONXURHW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 110.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|