C32H23N5O5S2 — CID 126103510
ethyl (2E,5S)-2-[(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126103510) has the molecular formula C32H23N5O5S2 and a molecular weight of 621.70 g/mol. Its IUPAC name is ethyl (2E,5S)-2-[(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-[(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126103510 |
| Molecular Formula | C32H23N5O5S2 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.11 |
| IUPAC Name | ethyl (2E,5S)-2-[(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C/c3cc([N+](=O)[O-])ccc3Sc3ncccn3)c(=O)n2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H23N5O5S2/c1-2-42-30(39)26-27(20-10-5-3-6-11-20)35-32-36(28(26)21-12-7-4-8-13-21)29(38)25(44-32)19-22-18-23(37(40)41)14-15-24(22)43-31-33-16-9-17-34-31/h3-19,28H,2H2,1H3/b25-19+/t28-/m0/s1 |
| InChIKey | MQBWICJVSBYESJ-KJANZVAVSA-N |
| XLogP | 4.78 |
| TPSA | 129.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|