C34H33N5O6S — CID 129442959
ethyl (5S)-5-(4-methoxyphenyl)-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 129442959) has the molecular formula C34H33N5O6S and a molecular weight of 639.73 g/mol. Its IUPAC name is ethyl (5S)-5-(4-methoxyphenyl)-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5S)-5-(4-methoxyphenyl)-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 129442959 |
| Molecular Formula | C34H33N5O6S |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | ethyl (5S)-5-(4-methoxyphenyl)-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2sc(=Cc3cc([N+](=O)[O-])ccc3N3CCN(C)CC3)c(=O)n2[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C34H33N5O6S/c1-4-45-33(41)29-30(22-8-6-5-7-9-22)35-34-38(31(29)23-10-13-26(44-3)14-11-23)32(40)28(46-34)21-24-20-25(39(42)43)12-15-27(24)37-18-16-36(2)17-19-37/h5-15,20-21,31H,4,16-19H2,1-3H3/t31-/m0/s1 |
| InChIKey | KBMCHLFCBITSKC-HKBQPEDESA-N |
| XLogP | 3.60 |
| TPSA | 119.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|