C31H35N5O8S — CID 6112077
ethyl (2Z)-7-methyl-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5-(3,4,5-trimethoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 6112077) has the molecular formula C31H35N5O8S and a molecular weight of 637.72 g/mol. Its IUPAC name is ethyl (2Z)-7-methyl-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5-(3,4,5-trimethoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z)-7-methyl-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5-(3,4,5-trimethoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 6112077 |
| Molecular Formula | C31H35N5O8S |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | ethyl (2Z)-7-methyl-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5-(3,4,5-trimethoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3cc([N+](=O)[O-])ccc3N3CCN(C)CC3)c(=O)n2C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C31H35N5O8S/c1-7-44-30(38)26-18(2)32-31-35(27(26)20-15-23(41-4)28(43-6)24(16-20)42-5)29(37)25(45-31)17-19-14-21(36(39)40)8-9-22(19)34-12-10-33(3)11-13-34/h8-9,14-17,27H,7,10-13H2,1-6H3/b25-17- |
| InChIKey | GFDRTJRQOWLBSL-UQQQWYQISA-N |
| XLogP | 2.48 |
| TPSA | 137.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|