C27H25FN4O5S — CID 129442251
ethyl (5R)-5-(4-fluorophenyl)-7-methyl-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 129442251) has the molecular formula C27H25FN4O5S and a molecular weight of 536.59 g/mol. Its IUPAC name is ethyl (5R)-5-(4-fluorophenyl)-7-methyl-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5R)-5-(4-fluorophenyl)-7-methyl-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 129442251 |
| Molecular Formula | C27H25FN4O5S |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | ethyl (5R)-5-(4-fluorophenyl)-7-methyl-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3cc([N+](=O)[O-])ccc3N3CCCC3)c(=O)n2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H25FN4O5S/c1-3-37-26(34)23-16(2)29-27-31(24(23)17-6-8-19(28)9-7-17)25(33)22(38-27)15-18-14-20(32(35)36)10-11-21(18)30-12-4-5-13-30/h6-11,14-15,24H,3-5,12-13H2,1-2H3/t24-/m1/s1 |
| InChIKey | FVQGZHIEZXIJEK-XMMPIXPASA-N |
| XLogP | 3.45 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|