C30H32N4O7S — CID 129442805
ethyl (5S)-5-(3-ethoxy-4-methoxyphenyl)-7-methyl-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 129442805) has the molecular formula C30H32N4O7S and a molecular weight of 592.67 g/mol. Its IUPAC name is ethyl (5S)-5-(3-ethoxy-4-methoxyphenyl)-7-methyl-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5S)-5-(3-ethoxy-4-methoxyphenyl)-7-methyl-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 129442805 |
| Molecular Formula | C30H32N4O7S |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | ethyl (5S)-5-(3-ethoxy-4-methoxyphenyl)-7-methyl-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3cc([N+](=O)[O-])ccc3N3CCCC3)c(=O)n2[C@H]1c1ccc(OC)c(OCC)c1 |
| InChI | InChI=1S/C30H32N4O7S/c1-5-40-24-16-19(9-12-23(24)39-4)27-26(29(36)41-6-2)18(3)31-30-33(27)28(35)25(42-30)17-20-15-21(34(37)38)10-11-22(20)32-13-7-8-14-32/h9-12,15-17,27H,5-8,13-14H2,1-4H3/t27-/m0/s1 |
| InChIKey | JEGGGDGUVAJTJD-MHZLTWQESA-N |
| XLogP | 3.71 |
| TPSA | 125.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|