C33H24BrN3O7S — CID 21207436
ethyl (2Z)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-(4-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 21207436) has the molecular formula C33H24BrN3O7S and a molecular weight of 686.54 g/mol. Its IUPAC name is ethyl (2Z)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-(4-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-(4-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 21207436 |
| Molecular Formula | C33H24BrN3O7S |
| Molecular Weight | 686.54 g/mol |
| Exact Mass | 685.05 |
| IUPAC Name | ethyl (2Z)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-(4-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3ccc(-c4ccc([N+](=O)[O-])cc4Br)o3)c(=O)n2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H24BrN3O7S/c1-3-43-32(39)28-29(19-7-5-4-6-8-19)35-33-36(30(28)20-9-12-22(42-2)13-10-20)31(38)27(45-33)18-23-14-16-26(44-23)24-15-11-21(37(40)41)17-25(24)34/h4-18,30H,3H2,1-2H3/b27-18- |
| InChIKey | WJRVBGKMNRCLEM-IMRQLAEWSA-N |
| XLogP | 5.87 |
| TPSA | 126.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|