C34H26BrN3O8S — CID 124586694
ethyl (2Z,5R)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-(3,4-dimethoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124586694) has the molecular formula C34H26BrN3O8S and a molecular weight of 716.57 g/mol. Its IUPAC name is ethyl (2Z,5R)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-(3,4-dimethoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-(3,4-dimethoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124586694 |
| Molecular Formula | C34H26BrN3O8S |
| Molecular Weight | 716.57 g/mol |
| Exact Mass | 715.06 |
| IUPAC Name | ethyl (2Z,5R)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-(3,4-dimethoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3ccc(-c4ccc([N+](=O)[O-])cc4Br)o3)c(=O)n2[C@@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C34H26BrN3O8S/c1-4-45-33(40)29-30(19-8-6-5-7-9-19)36-34-37(31(29)20-10-14-26(43-2)27(16-20)44-3)32(39)28(47-34)18-22-12-15-25(46-22)23-13-11-21(38(41)42)17-24(23)35/h5-18,31H,4H2,1-3H3/b28-18-/t31-/m1/s1 |
| InChIKey | OZSHRFLDBOOXNK-FABFSAKGSA-N |
| XLogP | 5.88 |
| TPSA | 135.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|