C37H33N3O9S — CID 129442895
ethyl (5R)-5-(3,4-diethoxyphenyl)-2-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 129442895) has the molecular formula C37H33N3O9S and a molecular weight of 695.75 g/mol. Its IUPAC name is ethyl (5R)-5-(3,4-diethoxyphenyl)-2-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5R)-5-(3,4-diethoxyphenyl)-2-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 129442895 |
| Molecular Formula | C37H33N3O9S |
| Molecular Weight | 695.75 g/mol |
| Exact Mass | 695.19 |
| IUPAC Name | ethyl (5R)-5-(3,4-diethoxyphenyl)-2-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2sc(=Cc3ccc(-c4cc([N+](=O)[O-])ccc4OC)o3)c(=O)n2[C@@H]1c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C37H33N3O9S/c1-5-46-29-16-13-23(19-30(29)47-6-2)34-32(36(42)48-7-3)33(22-11-9-8-10-12-22)38-37-39(34)35(41)31(50-37)21-25-15-18-28(49-25)26-20-24(40(43)44)14-17-27(26)45-4/h8-21,34H,5-7H2,1-4H3/t34-/m1/s1 |
| InChIKey | JTRFRJSSTALKDH-UUWRZZSWSA-N |
| XLogP | 5.91 |
| TPSA | 144.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|