C33H25N3O7S — CID 124557037
ethyl (2Z,5R)-2-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124557037) has the molecular formula C33H25N3O7S and a molecular weight of 607.64 g/mol. Its IUPAC name is ethyl (2Z,5R)-2-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-2-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124557037 |
| Molecular Formula | C33H25N3O7S |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | ethyl (2Z,5R)-2-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3ccc(-c4cc([N+](=O)[O-])ccc4OC)o3)c(=O)n2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C33H25N3O7S/c1-3-42-32(38)28-29(20-10-6-4-7-11-20)34-33-35(30(28)21-12-8-5-9-13-21)31(37)27(44-33)19-23-15-17-26(43-23)24-18-22(36(39)40)14-16-25(24)41-2/h4-19,30H,3H2,1-2H3/b27-19-/t30-/m1/s1 |
| InChIKey | VRGNBZIADBHBGK-ZHGFHMGHSA-N |
| XLogP | 5.11 |
| TPSA | 126.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|