C33H25N3O6S — CID 124557035
ethyl (2Z,5R)-2-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124557035) has the molecular formula C33H25N3O6S and a molecular weight of 591.65 g/mol. Its IUPAC name is ethyl (2Z,5R)-2-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-2-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124557035 |
| Molecular Formula | C33H25N3O6S |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | ethyl (2Z,5R)-2-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3ccc(-c4ccc(C)cc4[N+](=O)[O-])o3)c(=O)n2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C33H25N3O6S/c1-3-41-32(38)28-29(21-10-6-4-7-11-21)34-33-35(30(28)22-12-8-5-9-13-22)31(37)27(43-33)19-23-15-17-26(42-23)24-16-14-20(2)18-25(24)36(39)40/h4-19,30H,3H2,1-2H3/b27-19-/t30-/m1/s1 |
| InChIKey | ZPAKUOWTKIYXLL-ZHGFHMGHSA-N |
| XLogP | 5.41 |
| TPSA | 116.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|