C32H21ClFN3O6S — CID 21207541
ethyl (2Z)-2-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-5-(4-fluorophenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 21207541) has the molecular formula C32H21ClFN3O6S and a molecular weight of 630.05 g/mol. Its IUPAC name is ethyl (2Z)-2-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-5-(4-fluorophenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z)-2-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-5-(4-fluorophenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 21207541 |
| Molecular Formula | C32H21ClFN3O6S |
| Molecular Weight | 630.05 g/mol |
| Exact Mass | 629.08 |
| IUPAC Name | ethyl (2Z)-2-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-5-(4-fluorophenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3ccc(-c4ccc(Cl)cc4[N+](=O)[O-])o3)c(=O)n2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C32H21ClFN3O6S/c1-2-42-31(39)27-28(18-6-4-3-5-7-18)35-32-36(29(27)19-8-11-21(34)12-9-19)30(38)26(44-32)17-22-13-15-25(43-22)23-14-10-20(33)16-24(23)37(40)41/h3-17,29H,2H2,1H3/b26-17- |
| InChIKey | KQLJYGMEJIOANT-ONUIUJJFSA-N |
| XLogP | 5.90 |
| TPSA | 116.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.05 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|