C30H25N3O7S — CID 124533708
ethyl (2Z,5R)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124533708) has the molecular formula C30H25N3O7S and a molecular weight of 571.61 g/mol. Its IUPAC name is ethyl (2Z,5R)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124533708 |
| Molecular Formula | C30H25N3O7S |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | ethyl (2Z,5R)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-oxo-5,7-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3cc(OC)c(OC)cc3[N+](=O)[O-])c(=O)n2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H25N3O7S/c1-4-40-29(35)25-26(18-11-7-5-8-12-18)31-30-32(27(25)19-13-9-6-10-14-19)28(34)24(41-30)16-20-15-22(38-2)23(39-3)17-21(20)33(36)37/h5-17,27H,4H2,1-3H3/b24-16-/t27-/m1/s1 |
| InChIKey | ZKLXMDAWUUYXSB-MZANGIHLSA-N |
| XLogP | 3.86 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|