C25H22ClN3O7S — CID 2258966
ethyl (2Z,5S)-5-(2-chlorophenyl)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 2258966) has the molecular formula C25H22ClN3O7S and a molecular weight of 543.99 g/mol. Its IUPAC name is ethyl (2Z,5S)-5-(2-chlorophenyl)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5S)-5-(2-chlorophenyl)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2258966 |
| Molecular Formula | C25H22ClN3O7S |
| Molecular Weight | 543.99 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | ethyl (2Z,5S)-5-(2-chlorophenyl)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3cc(OC)c(OC)cc3[N+](=O)[O-])c(=O)n2[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C25H22ClN3O7S/c1-5-36-24(31)21-13(2)27-25-28(22(21)15-8-6-7-9-16(15)26)23(30)20(37-25)11-14-10-18(34-3)19(35-4)12-17(14)29(32)33/h6-12,22H,5H2,1-4H3/b20-11-/t22-/m1/s1 |
| InChIKey | XQFPKUGUKDIFTI-VMOHIOPYSA-N |
| XLogP | 3.38 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.99 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|