C26H25N3O8S — CID 2251669
ethyl (2Z,5R)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-5-(3-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 2251669) has the molecular formula C26H25N3O8S and a molecular weight of 539.57 g/mol. Its IUPAC name is ethyl (2Z,5R)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-5-(3-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-5-(3-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2251669 |
| Molecular Formula | C26H25N3O8S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | ethyl (2Z,5R)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-5-(3-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3cc(OC)c(OC)cc3[N+](=O)[O-])c(=O)n2[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C26H25N3O8S/c1-6-37-25(31)22-14(2)27-26-28(23(22)15-8-7-9-17(10-15)34-3)24(30)21(38-26)12-16-11-19(35-4)20(36-5)13-18(16)29(32)33/h7-13,23H,6H2,1-5H3/b21-12-/t23-/m1/s1 |
| InChIKey | IQGZIZLMPLMLHB-VVOOWDFBSA-N |
| XLogP | 2.73 |
| TPSA | 131.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|