C24H20N3O7S- — CID 2199484
4-[(Z)-[(5S)-6-ethoxycarbonyl-5-(2-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-2-nitrophenolate (PubChem CID 2199484) has the molecular formula C24H20N3O7S- and a molecular weight of 494.51 g/mol. Its IUPAC name is 4-[(Z)-[(5S)-6-ethoxycarbonyl-5-(2-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[(Z)-[(5S)-6-ethoxycarbonyl-5-(2-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 2199484 |
| Molecular Formula | C24H20N3O7S- |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 4-[(Z)-[(5S)-6-ethoxycarbonyl-5-(2-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-2-nitrophenolate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccc([O-])c([N+](=O)[O-])c3)c(=O)n2[C@H]1c1ccccc1OC |
| InChI | InChI=1S/C24H21N3O7S/c1-4-34-23(30)20-13(2)25-24-26(21(20)15-7-5-6-8-18(15)33-3)22(29)19(35-24)12-14-9-10-17(28)16(11-14)27(31)32/h5-12,21,28H,4H2,1-3H3/p-1/b19-12-/t21-/m0/s1 |
| InChIKey | FIDCXUJDBRDPRI-JCAJYURWSA-M |
| XLogP | 1.79 |
| TPSA | 136.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|