C28H29N3O8S — CID 126021181
2-methoxyethyl (2E,5R)-2-[(4-methoxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5-(2-propoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126021181) has the molecular formula C28H29N3O8S and a molecular weight of 567.62 g/mol. Its IUPAC name is 2-methoxyethyl (2E,5R)-2-[(4-methoxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5-(2-propoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl (2E,5R)-2-[(4-methoxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5-(2-propoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126021181 |
| Molecular Formula | C28H29N3O8S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 2-methoxyethyl (2E,5R)-2-[(4-methoxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5-(2-propoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCCOc1ccccc1[C@@H]1C(C(=O)OCCOC)=C(C)N=c2s/c(=C/c3ccc(OC)c([N+](=O)[O-])c3)c(=O)n21 |
| InChI | InChI=1S/C28H29N3O8S/c1-5-12-38-21-9-7-6-8-19(21)25-24(27(33)39-14-13-36-3)17(2)29-28-30(25)26(32)23(40-28)16-18-10-11-22(37-4)20(15-18)31(34)35/h6-11,15-16,25H,5,12-14H2,1-4H3/b23-16+/t25-/m1/s1 |
| InChIKey | NDNIGFWNUHYZGZ-OWXSRONMSA-N |
| XLogP | 3.13 |
| TPSA | 131.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|