C23H17ClN3O6S- — CID 7031560
4-[[(5S)-5-(4-chlorophenyl)-6-ethoxycarbonyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-2-nitrophenolate (PubChem CID 7031560) has the molecular formula C23H17ClN3O6S- and a molecular weight of 498.92 g/mol. Its IUPAC name is 4-[[(5S)-5-(4-chlorophenyl)-6-ethoxycarbonyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[[(5S)-5-(4-chlorophenyl)-6-ethoxycarbonyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7031560 |
| Molecular Formula | C23H17ClN3O6S- |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 4-[[(5S)-5-(4-chlorophenyl)-6-ethoxycarbonyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]-2-nitrophenolate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3ccc([O-])c([N+](=O)[O-])c3)c(=O)n2[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3O6S/c1-3-33-22(30)19-12(2)25-23-26(20(19)14-5-7-15(24)8-6-14)21(29)18(34-23)11-13-4-9-17(28)16(10-13)27(31)32/h4-11,20,28H,3H2,1-2H3/p-1/t20-/m0/s1 |
| InChIKey | NHLQWTDDOZDGGM-FQEVSTJZSA-M |
| XLogP | 2.43 |
| TPSA | 126.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|