C24H20ClN3O7S — CID 4596375
2-methoxyethyl 5-(4-chlorophenyl)-2-[(4-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 4596375) has the molecular formula C24H20ClN3O7S and a molecular weight of 529.96 g/mol. Its IUPAC name is 2-methoxyethyl 5-(4-chlorophenyl)-2-[(4-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 5-(4-chlorophenyl)-2-[(4-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4596375 |
| Molecular Formula | C24H20ClN3O7S |
| Molecular Weight | 529.96 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | 2-methoxyethyl 5-(4-chlorophenyl)-2-[(4-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(O)c([N+](=O)[O-])c3)c(=O)n2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClN3O7S/c1-13-20(23(31)35-10-9-34-2)21(15-4-6-16(25)7-5-15)27-22(30)19(36-24(27)26-13)12-14-3-8-18(29)17(11-14)28(32)33/h3-8,11-12,21,29H,9-10H2,1-2H3 |
| InChIKey | LQWCWYJXABVIJD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.96 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|