C26H25ClN4O4S — CID 126110435
(2Z,5R)-5-(4-chlorophenyl)-N,N-diethyl-7-methyl-2-[(4-methyl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126110435) has the molecular formula C26H25ClN4O4S and a molecular weight of 525.03 g/mol. Its IUPAC name is (2Z,5R)-5-(4-chlorophenyl)-N,N-diethyl-7-methyl-2-[(4-methyl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2Z,5R)-5-(4-chlorophenyl)-N,N-diethyl-7-methyl-2-[(4-methyl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126110435 |
| Molecular Formula | C26H25ClN4O4S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | (2Z,5R)-5-(4-chlorophenyl)-N,N-diethyl-7-methyl-2-[(4-methyl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C\c3ccc(C)c([N+](=O)[O-])c3)c(=O)n2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25ClN4O4S/c1-5-29(6-2)25(33)22-16(4)28-26-30(23(22)18-9-11-19(27)12-10-18)24(32)21(36-26)14-17-8-7-15(3)20(13-17)31(34)35/h7-14,23H,5-6H2,1-4H3/b21-14-/t23-/m1/s1 |
| InChIKey | DLUYGDFLJVNEBA-LJJBLSSYSA-N |
| XLogP | 3.97 |
| TPSA | 97.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|